CAS 845253-10-3

α-2-Propen-1-yl-3-furanmethanamine

Description:

α-2-Propen-1-yl-3-furanmethanamine, also known by its CAS number 845253-10-3, is an organic compound characterized by its unique structure that includes a furan ring and an amine functional group. This compound typically exhibits properties associated with both amines and furan derivatives, such as potential reactivity due to the presence of the amine group, which can participate in nucleophilic reactions. The furan moiety contributes to its aromatic characteristics and may influence its solubility and stability. Generally, compounds like this can be of interest in various fields, including medicinal chemistry and materials science, due to their potential biological activity and utility in synthesizing more complex molecules. Additionally, the presence of the propenyl group suggests that it may undergo polymerization or other reactions under certain conditions, making it a candidate for further study in synthetic applications. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined through experimental methods or detailed literature review.

Formula: C₈H₁₁NO

InChI: InChI=1S/C8H11NO/c1-2-3-8(9)7-4-5-10-6-7/h2,4-6,8H,1,3,9H2

InChI key: InChIKey=FTCIZTPKHSUQEM-UHFFFAOYSA-N

SMILES: C(CC=C)(N)C=1C=COC1

Synonyms:

• 3-Furanmethanamine, α-2-propen-1-yl-
• 3-Furanmethanamine, α-2-propenyl-
• α-2-Propen-1-yl-3-furanmethanamine
• 1-(Furan-3-yl)but-3-en-1-amine
• 1-(3-Furyl)but-3-enylamine