CAS 845266-24-2
:2-[[5-(Trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile
Description:
2-[[5-(Trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile, with the CAS number 845266-24-2, is a chemical compound characterized by its unique structure that includes a pyridine ring substituted with a trifluoromethyl group and a sulfonyl moiety. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of the sulfonyl group and the trifluoromethyl group, which can influence its solubility in various solvents. It is often utilized in pharmaceutical and agrochemical research due to its potential biological activity. The presence of the acetonitrile functional group suggests that it may participate in nucleophilic reactions, making it a versatile intermediate in organic synthesis. Additionally, the trifluoromethyl group is known to enhance the lipophilicity and metabolic stability of compounds, which can be advantageous in drug development. Overall, this compound's distinctive features make it a subject of interest in various chemical applications, particularly in the synthesis of more complex molecules.
Formula:C8H5F3N2O2S
InChI:InChI=1S/C8H5F3N2O2S/c9-8(10,11)6-1-2-7(13-5-6)16(14,15)4-3-12/h1-2,5H,4H2
InChI key:InChIKey=QHSGLINBMNSOOR-UHFFFAOYSA-N
SMILES:S(CC#N)(=O)(=O)C1=CC=C(C(F)(F)F)C=N1
Synonyms:- 2-[[5-(Trifluoromethyl)-2-pyridinyl]sulfonyl]acetonitrile
- 2-{[5-(Trifluoromethyl)-2-Pyridyl]Sulfonyl}Acetonitrile
- Acetonitrile, 2-[[5-(Trifluoromethyl)-2-Pyridinyl]Sulfonyl]-
- Acetonitrile, [[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-
- {[5-(Trifluoromethyl)pyridin-2-yl]sulfonyl}acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.