CAS 845266-27-5

4-Nitro-5-(1-piperazinyl)-2-thiophenesulfonamide

Description:

4-Nitro-5-(1-piperazinyl)-2-thiophenesulfonamide is a chemical compound characterized by its unique structure, which includes a thiophene ring, a sulfonamide group, and a piperazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the nitro group suggests it may participate in electrophilic reactions, while the sulfonamide group can influence its solubility and reactivity. The piperazine ring is known for its role in enhancing pharmacological properties, often contributing to the compound's ability to interact with biological targets. This substance may exhibit antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Additionally, its solubility and stability can be influenced by the functional groups present, which may affect its application in various fields, including pharmaceuticals. As with many chemical compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₈H₁₂N₄O₄S₂

InChI: InChI=1/C8H12N4O4S2/c9-18(15,16)7-5-6(12(13)14)8(17-7)11-3-1-10-2-4-11/h5,10H,1-4H2,(H2,9,15,16)

InChI key: InChIKey=HQYILIGGLRWEOU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(SC(S(N)(=O)=O)=C1)N2CCNCC2

Synonyms:

• 2-Thiophenesulfonamide, 4-Nitro-5-(1-Piperazinyl)-
• 4-Nitro-5-(1-piperazinyl)-2-thiophenesulfonamide
• 4-Nitro-5-(piperazin-1-yl)thiophene-2-sulfonamide
• 4-Nitro-5-Piperazinothiophene-2-Sulfonamide
• 4-Nitro-5-piperazin-1-yl-thiophene-2-sulfonic acidamide
• 4-Nitro-5-piperazin-1-ylthiophene-2-sulfonamide

4-Nitro-5-piperazin-1-ylthiophene-2-sulfonamide

CAS: 845266-27-5

4-Nitro-5-piperazin-1-ylthiophene-2-sulfonamide

Purity: ≥95%

Molecular weight: 292.34g/mol

Ref: 54-OR110022