
CAS 845267-73-4
:5,5-Diethyl-2,4-piperidinedione
Description:
5,5-Diethyl-2,4-piperidinedione, identified by its CAS number 845267-73-4, is a chemical compound characterized by its piperidine ring structure, which features two ethyl groups at the 5-position and diketone functionalities at the 2 and 4 positions. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its moderate polarity. The presence of the diketone groups contributes to its reactivity, allowing it to participate in various chemical reactions, including condensation and cyclization processes. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the synthesis of bioactive compounds. Additionally, the compound's unique substituents may influence its pharmacological properties, making it a subject of interest in drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5,5-Diethyl-2,4-piperidinedione represents a versatile building block in organic synthesis and pharmaceutical research.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c1-3-9(4-2)6-10-8(12)5-7(9)11/h3-6H2,1-2H3,(H,10,12)
InChI key:InChIKey=WBOCXDUCYRBDMU-UHFFFAOYSA-N
SMILES:C(C)C1(CC)C(=O)CC(=O)NC1
Synonyms:- 5,5-Diethyl-2,4-piperidinedione
- 5,5-Diethylpiperidine-2,4-dione
- 2,4-Piperidinedione, 5,5-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.