CAS 845305-87-5
:5-bromo-N-methylpyridine-2-carboxamide
Description:
5-Bromo-N-methylpyridine-2-carboxamide is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position of the pyridine ring contributes to its reactivity and potential applications in various chemical reactions. The N-methyl group indicates that a methyl group is attached to the nitrogen atom of the amide functional group, enhancing its solubility and influencing its biological activity. The carboxamide functional group (-C(=O)NH2) is known for its ability to participate in hydrogen bonding, which can affect the compound's physical properties, such as melting point and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and reactivity can vary based on the context of its use, including potential roles in synthesis or as a building block in drug development. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C7H7BrN2O
InChI:InChI=1/C7H7BrN2O/c1-9-7(11)6-3-2-5(8)4-10-6/h2-4H,1H3,(H,9,11)
SMILES:CNC(=O)c1ccc(cn1)Br
Synonyms:- 5-Bromo-pyridine-2-carboxylic acid methylamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-N-methylpyridine-2-carboxamide, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7BrN2OPurity:96%Molecular weight:215.05N-Methyl 5-bromopicolinamide
CAS:Formula:C7H7BrN2OPurity:95%Color and Shape:SolidMolecular weight:215.04735-Bromo-N-methylpyridine-2-carboxamide
CAS:5-Bromo-N-methylpyridine-2-carboxamideFormula:C7H7BrN2OPurity:98%Color and Shape: white to off-white solidMolecular weight:215.05g/mol5-Bromo-N-methylpicolinamide
CAS:Formula:C7H7BrN2OPurity:97%Color and Shape:SolidMolecular weight:215.05



