CAS 845305-91-1

5-bromo-N-cyclopentyl-pyridine-2-carboxamide

Description:

5-Bromo-N-cyclopentyl-pyridine-2-carboxamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a cyclopentyl group. The presence of the carboxamide functional group contributes to its potential as a bioactive molecule. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The bromine substitution can influence the compound's reactivity and biological activity, while the cyclopentyl group may enhance lipophilicity, affecting its pharmacokinetic properties. As with many compounds in this class, safety and handling precautions are essential, as it may possess toxicological properties. Overall, 5-bromo-N-cyclopentyl-pyridine-2-carboxamide represents a compound with potential applications in research and pharmaceuticals, warranting further investigation into its properties and effects.

Formula: C₁₁H₁₃BrN₂O

InChI: InChI=1/C11H13BrN2O/c12-8-5-6-10(13-7-8)11(15)14-9-3-1-2-4-9/h5-7,9H,1-4H2,(H,14,15)

SMILES: C1CCC(C1)NC(=O)c1ccc(cn1)Br

Synonyms:

• 5-Bromo-N-cyclopentylpicolinamide
• N-Cyclopentyl 5-bromopicolinamide
• N-cyclopentyl 5-bromopyridine-2-carboxamide
• 5-Bromo-N-cyclopentylpicolinamide ISO 9001：2015 REACH
• 5-Bromo-N-cyclopentylpyridine-2-carboxamide
• 2-Pyridinecarboxamide, 5-bromo-N-cyclopentyl-

N-Cyclopentyl 5-bromopicolinamide

CAS: 845305-91-1

Formula: C₁₁H₁₃BrN₂O

Molecular weight: 269.1377

Ref: IN-DA003MKM

5-Bromo-N-cyclopentylpyridine-2-carboxamide

CAS: 845305-91-1

5-Bromo-N-cyclopentylpyridine-2-carboxamide

Purity: ≥95%

Molecular weight: 269.14g/mol

Ref: 54-OR11914