CAS 845306-06-1

4-Bromo-N-(1-methylethyl)-2-pyridinecarboxamide

Description:

4-Bromo-N-(1-methylethyl)-2-pyridinecarboxamide, with the CAS number 845306-06-1, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 4-position of the pyridine ring introduces significant electronegativity, influencing the compound's reactivity and potential interactions. The N-(1-methylethyl) substituent indicates that there is an isopropyl group attached to the nitrogen atom, which can affect the compound's steric and electronic properties. This compound is likely to exhibit moderate solubility in organic solvents due to its polar amide functional group and the aromatic nature of the pyridine ring. It may participate in hydrogen bonding due to the amide group, which can influence its boiling and melting points. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the pyridine ring can lead to varied biological activities.

Formula: C₉H₁₁BrN₂O

InChI: InChI=1S/C9H11BrN2O/c1-6(2)12-9(13)8-5-7(10)3-4-11-8/h3-6H,1-2H3,(H,12,13)

InChI key: InChIKey=YSEARHIWCSGRSZ-UHFFFAOYSA-N

SMILES: C(NC(C)C)(=O)C1=CC(Br)=CC=N1

Synonyms:

• 2-Pyridinecarboxamide, 4-bromo-N-(1-methylethyl)-
• 4-Bromo-N-(1-methylethyl)-2-pyridinecarboxamide