CAS 845307-48-4

2,2'-Bipyridine-4,4'-dipropenoic acid

Description:

2,2'-Bipyridine-4,4'-dipropenoic acid is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 2 and 2' positions, with propenoic acid groups attached at the 4 and 4' positions. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in coordination chemistry and materials science due to its ability to form chelates with metal ions. The presence of the propenoic acid moieties suggests that it may participate in polymerization reactions or serve as a building block for more complex organic materials. Additionally, the bipyridine framework can contribute to its electronic properties, making it useful in various chemical and photophysical applications. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 2,2'-Bipyridine-4,4'-dipropenoic acid is a versatile compound with significant potential in both academic research and industrial applications.

Formula: C₁₆H₁₂N₂O₄

InChI: InChI=1/C16H12N2O4/c19-15(20)3-1-11-5-7-17-13(9-11)14-10-12(6-8-18-14)2-4-16(21)22/h1-10H,(H,19,20)(H,21,22)

SMILES: C(=CC(=O)O)c1ccnc(c1)c1cc(C=CC(=O)O)ccn1

Synonyms:

• 3,3'-[2,2'-Bipyridine]-4,4'-diylbis-(2E,2'E)-2-propenoic acid
• 2-Propenoic acid, 3,3'-[2,2'-bipyridine]-4,4'-diylbis-, (2E,2'E)-
• 4,4'-bis(E,E-carboxyvinyl)-2,2'-bipyridine
• RARECHEM AL BK 0816
• 4,4'-Bis [2-(4-methoxyphenyl)ethenyl]-2,2'-bipyridine
• 2,2'-Bipyridine-4,4'-dipropenoic acid