CAS 84538-47-6

4-Chloro-2-methoxy-6-methyl-5-nitropyrimidine

Description:

4-Chloro-2-methoxy-6-methyl-5-nitropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features several functional groups, including a chloro group at position 4, a methoxy group at position 2, a methyl group at position 6, and a nitro group at position 5. These substituents contribute to its chemical reactivity and potential applications in various fields, such as pharmaceuticals and agrochemicals. The presence of the nitro group typically enhances the compound's electrophilic character, making it useful in further chemical transformations. Additionally, the methoxy group can influence solubility and biological activity. The compound's molecular structure suggests it may exhibit interesting biological properties, which could be explored in drug development or as a building block in organic synthesis. As with many nitrogen-containing heterocycles, it may also display unique physical properties, such as melting point and solubility, influenced by its substituents.

Formula: C₆H₆ClN₃O₃

InChI: InChI=1S/C6H6ClN3O3/c1-3-4(10(11)12)5(7)9-6(8-3)13-2/h1-2H3

InChI key: InChIKey=JDWRKIIBNHCUHM-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C)=NC(OC)=NC1Cl

Synonyms:

• Pyrimidine, 4-chloro-2-methoxy-6-methyl-5-nitro-
• 4-Chloro-2-methoxy-6-methyl-5-nitropyrimidine