CymitQuimica logo

CAS 84539-10-6

:

3-Bromo-N-methyl-2-pyrazinamine

Description:
3-Bromo-N-methyl-2-pyrazinamine is an organic compound characterized by its pyrazinamine structure, which features a pyrazine ring substituted with a bromine atom and a methylamino group. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical synthesis applications, particularly in medicinal chemistry and the development of pharmaceuticals. The N-methyl group enhances its lipophilicity, potentially influencing its biological activity and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 3-Bromo-N-methyl-2-pyrazinamine serves as a valuable intermediate in organic synthesis and research.
Formula:C5H6BrN3
InChI:InChI=1S/C5H6BrN3/c1-7-5-4(6)8-2-3-9-5/h2-3H,1H3,(H,7,9)
InChI key:InChIKey=FPYJZKKYLJEMCX-UHFFFAOYSA-N
SMILES:N(C)C=1C(Br)=NC=CN1
Synonyms:
  • 2-Pyrazinamine, 3-bromo-N-methyl-
  • Pyrazinamine, 3-bromo-N-methyl-
  • 3-Bromo-N-methyl-2-pyrazinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.