CAS 84539-30-0

5-bromo-N-methylpyridin-2-amine

Description:

5-Bromo-N-methylpyridin-2-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methylamino group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in polar organic solvents. It is often used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The bromine substituent can enhance reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the methylamino group can influence the compound's basicity and overall reactivity. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings. Overall, 5-bromo-N-methylpyridin-2-amine is a valuable compound in synthetic organic chemistry and drug development.

Formula: C₆H₇BrN₂

InChI: InChI=1S/C6H7BrN2/c1-8-6-3-2-5(7)4-9-6/h2-4H,1H3,(H,8,9)

SMILES: CN=c1ccc(c[nH]1)Br

Synonyms:

• 2-(Methylamino)-5-bromopyridine
• N-Methyl-5-bromopyridine-2-amine
• 5-Bromo-2-(methylamino)pyridine

5-Bromo-N-methylpyridin-2-amine

CAS: 84539-30-0

Formula: C₆H₇BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 187.0372

Ref: IN-DA0053WM

5-Bromo-2-(N-methylamino)pyridine

CAS: 84539-30-0

5-Bromo-2-(N-methylamino)pyridine

Purity: 97%

Molecular weight: 187.04g/mol

Ref: 54-OR901635

5-Bromo-N-methylpyridin-2-amine

CAS: 84539-30-0

Formula: C₆H₇BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 187.04

Ref: 10-F078710

5-Bromo-2-(N-methylamino)pyridine

Controlled Product

CAS: 84539-30-0

Applications 5-Bromo-2-(N-methylamino)pyridine is useful for the synthetic preparation of halo aminopyridines.
References Sun, C., et al.: ACS Omega, 4, 10534 (2019)

Formula: C₆H₇BrN₂

Color and Shape: Neat

Molecular weight: 187.04

Ref: TR-B685643