CAS 84539-49-1

2,4,6-Tribromo-3-pyridinamine

Description:

2,4,6-Tribromo-3-pyridinamine is an organic compound characterized by its brominated pyridine structure. It features a pyridine ring with three bromine substituents at the 2, 4, and 6 positions, and an amino group at the 3 position. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in pharmaceuticals, agrochemicals, and as a reagent in organic synthesis. The presence of bromine atoms contributes to its reactivity, making it useful in various chemical reactions, including electrophilic substitution. Additionally, the amino group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Safety considerations are important when handling this compound, as brominated compounds can be hazardous. Overall, 2,4,6-Tribromo-3-pyridinamine is a significant compound in chemical research and applications, with properties that warrant careful study and handling.

Formula: C₅H₃Br₃N₂

InChI: InChI=1S/C5H3Br3N2/c6-2-1-3(7)10-5(8)4(2)9/h1H,9H2

InChI key: InChIKey=LUNVYJQHKVGADE-UHFFFAOYSA-N

SMILES: NC=1C(Br)=CC(Br)=NC1Br

Synonyms:

• 2,4,6-Tribromo-3-pyridinamine
• 3-Pyridinamine, 2,4,6-tribromo-
• Pyridine, 3-amino-2,4,6-tribromo-