
CAS 84540-70-5
:3-[[3-(Dimethylamino)propyl]amino]-1,2-propanediol
Description:
3-[[3-(Dimethylamino)propyl]amino]-1,2-propanediol, with the CAS number 84540-70-5, is a chemical compound characterized by its structure, which includes a propanediol backbone with amino groups and a dimethylamino substituent. This compound is typically classified as an amino alcohol, which suggests it possesses both alcohol and amine functional groups. Its molecular structure allows for potential applications in various fields, including pharmaceuticals and biochemistry, where it may serve as a building block or a reagent. The presence of the dimethylamino group indicates that it may exhibit basic properties, making it soluble in water and other polar solvents. Additionally, the compound's ability to form hydrogen bonds due to its hydroxyl groups can influence its reactivity and interactions with other molecules. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, this compound's unique characteristics make it of interest in both research and industrial applications.
Formula:C8H20N2O2
InChI:InChI=1S/C8H20N2O2/c1-10(2)5-3-4-9-6-8(12)7-11/h8-9,11-12H,3-7H2,1-2H3
InChI key:InChIKey=RXFQHLJNQDJBEG-UHFFFAOYSA-N
SMILES:C(NCC(CO)O)CCN(C)C
Synonyms:- 3-[[3-(Dimethylamino)propyl]amino]-1,2-propanediol
- 1,2-Propanediol, 3-[[3-(dimethylamino)propyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.