CAS 84547-88-6

4-Chloro-1-methyl-3-nitro-1H-pyrazole-5-carboxylic acid

Description:

4-Chloro-1-methyl-3-nitro-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a chloro group at the 4-position, a methyl group at the 1-position, and a nitro group at the 3-position of the pyrazole ring, along with a carboxylic acid functional group at the 5-position. The presence of these functional groups contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its chemical properties, such as acidity and reactivity, are influenced by the electron-withdrawing effects of the nitro and chloro substituents. Safety data should be consulted for handling, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest for its potential biological activity and utility in synthetic chemistry.

Formula: C₅H₄ClN₃O₄

InChI: InChI=1S/C5H4ClN3O4/c1-8-3(5(10)11)2(6)4(7-8)9(12)13/h1H3,(H,10,11)

InChI key: InChIKey=ZIBFUEQMNQITNU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Cl)C(N(=O)=O)=NN1C

Synonyms:

• 4-Chloro-1-methyl-3-nitro-1H-pyrazole-5-carboxylic acid
• 4-Chloro-1-methyl-5-pyrazolecarboxylic acid
• 1H-Pyrazole-5-carboxylic acid, 4-chloro-1-methyl-3-nitro-

4-Chloro-1-methyl-3-nitro-1H-pyrazole-5-carboxylic acid

CAS: 84547-88-6

Formula: C₅H₄ClN₃O₄

Molecular weight: 205.55

Ref: 10-F037422