CAS 845504-81-6
:2-bromo-1-(pyrimidin-4-yl)ethanone
Description:
2-bromo-1-(pyrimidin-4-yl)ethanone is an organic compound characterized by the presence of a bromine atom, a pyrimidine ring, and a ketone functional group. The structure features a bromine substituent at the second carbon of an ethyl chain, which is also attached to a pyrimidine ring at the first carbon. This compound is typically a solid at room temperature and is soluble in polar organic solvents. The presence of the pyrimidine moiety suggests potential biological activity, as pyrimidine derivatives are often found in pharmaceuticals and agrochemicals. The bromine atom can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 2-bromo-1-(pyrimidin-4-yl)ethanone is a versatile compound with potential applications in research and industry.
Formula:C6H5BrN2O
InChI:InChI=1/C6H5BrN2O/c7-3-6(10)5-1-2-8-4-9-5/h1-2,4H,3H2
SMILES:c1cncnc1C(=O)CBr
Synonyms:- Ethanone, 2-Bromo-1-(4-Pyrimidinyl)-
- 2-Bromo-1-(pyrimidin-4-yl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
