CAS 845546-17-0

1-(3-Ethoxypropyl)-5-oxo-3-pyrrolidinecarboxylic acid

Description:

1-(3-Ethoxypropyl)-5-oxo-3-pyrrolidinecarboxylic acid, identified by its CAS number 845546-17-0, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the ethoxypropyl substituent enhances its hydrophobic characteristics, which may influence its solubility in organic solvents. The oxo group (a carbonyl) at the 5-position of the pyrrolidine ring adds to its reactivity, potentially allowing for further functionalization. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH, temperature, and the presence of other reactive species.

Formula: C₁₀H₁₇NO₄

InChI: InChI=1S/C10H17NO4/c1-2-15-5-3-4-11-7-8(10(13)14)6-9(11)12/h8H,2-7H2,1H3,(H,13,14)

InChI key: InChIKey=VVPIRIYDBVTFNP-UHFFFAOYSA-N

SMILES: C(CCOCC)N1CC(C(O)=O)CC1=O

Synonyms:

• 1-(3-Ethoxypropyl)-5-oxo-3-pyrrolidinecarboxylic acid
• 3-Pyrrolidinecarboxylic acid, 1-(3-ethoxypropyl)-5-oxo-