CAS 845546-24-9
:1-[(2-Fluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid
Description:
1-[(2-Fluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid, identified by its CAS number 845546-24-9, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring, a carboxylic acid functional group, and a fluorophenyl moiety. This compound typically exhibits properties associated with both the pyrrolidine and aromatic systems, such as potential solubility in organic solvents and moderate polarity due to the presence of the carboxylic acid group. The fluorine atom in the 2-position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity and biological activity. Such compounds may be of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. The presence of the oxo group contributes to the compound's reactivity, making it a candidate for further chemical modifications. Overall, this compound's characteristics suggest it may play a role in various chemical and biological processes, warranting further investigation into its applications.
Formula:C12H12FNO3
InChI:InChI=1S/C12H12FNO3/c13-10-4-2-1-3-8(10)6-14-7-9(12(16)17)5-11(14)15/h1-4,9H,5-7H2,(H,16,17)
InChI key:InChIKey=HLGLVJXDNAWXLZ-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1=O)C2=C(F)C=CC=C2
Synonyms:- 1-(2-Fluoro-benzyl)-5-oxo-pyrrolidine-3-carboxylic acid
- 1-[(2-Fluorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid
- 3-Pyrrolidinecarboxylic acid, 1-[(2-fluorophenyl)methyl]-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.