CAS 84555-18-0
:Cyanomethyl 2-pyridinecarboxylate
Description:
Cyanomethyl 2-pyridinecarboxylate, with the CAS number 84555-18-0, is an organic compound characterized by its pyridine ring and a cyanomethyl functional group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. This compound features a carboxylate group, which contributes to its reactivity and potential applications in organic synthesis. Cyanomethyl 2-pyridinecarboxylate is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, owing to its ability to participate in nucleophilic reactions. Its molecular structure allows for hydrogen bonding and dipole interactions, influencing its solubility in polar solvents. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling. Overall, this compound is of interest in the field of medicinal chemistry and materials science due to its versatile reactivity and functional properties.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c9-4-6-12-8(11)7-3-1-2-5-10-7/h1-3,5H,6H2
InChI key:InChIKey=MBKFVEJIATUGNM-UHFFFAOYSA-N
SMILES:C(OCC#N)(=O)C1=CC=CC=N1
Synonyms:- 2-Pyridinecarboxylic acid, cyanomethyl ester
- Picolinic acid, cyanomethyl ester
- Cyanomethyl 2-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
