CAS 845551-41-9

(4-butoxy-3,5-dimethylphenyl)boronic acid

Description:

(4-butoxy-3,5-dimethylphenyl)boronic acid, with the CAS number 845551-41-9, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. This compound features a butoxy group and two methyl groups on the aromatic ring, which influence its solubility and reactivity. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis, particularly in cross-coupling reactions such as Suzuki-Miyaura coupling. The presence of the butoxy group enhances its solubility in organic solvents, while the methyl groups can affect the steric and electronic properties of the molecule. This compound may also exhibit potential applications in medicinal chemistry and materials science due to its unique structural features. As with many boronic acids, it is important to handle this substance with care, considering its reactivity and potential environmental impact.

Formula: C₁₂H₁₉BO₃

InChI: InChI=1/C12H19BO3/c1-4-5-6-16-12-9(2)7-11(13(14)15)8-10(12)3/h7-8,14-15H,4-6H2,1-3H3

SMILES: CCCCOc1c(C)cc(cc1C)B(O)O

(4-Butoxy-3,5-dimethylphenyl)boronic acid

CAS: 845551-41-9

Formula: C₁₂H₁₉BO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 222.0885

Ref: IN-DA003BV1

4-Butoxy-3,5-dimethylphenylboronic acid

CAS: 845551-41-9

4-Butoxy-3,5-dimethylphenylboronic acid

Purity: ≥95%

Molecular weight: 222.09g/mol

Ref: 54-OR360826

(4-Butoxy-3,5-dimethylphenyl)boronic acid

CAS: 845551-41-9

Formula: C₁₂H₁₉BO₃

Purity: ≥95%

Molecular weight: 222.09

Ref: 10-F228711