CAS 845555-46-6
:(2S)-2-amino-2-cyclohexyl-ethanol
Description:
(2S)-2-amino-2-cyclohexyl-ethanol is an organic compound characterized by its amino alcohol structure, featuring a cyclohexyl group attached to the second carbon of the ethanol backbone. This compound is chiral, with the (2S) designation indicating the specific stereochemistry at the chiral center. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both an amino group (-NH2) and a hydroxyl group (-OH) contributes to its potential as a versatile building block in organic synthesis and pharmaceuticals. The amino group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the cyclohexyl moiety provides hydrophobic characteristics. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its CAS number, 845555-46-6, allows for easy identification and reference in chemical databases and literature.
Formula:C8H17NO
InChI:InChI=1/C8H17NO/c9-8(6-10)7-4-2-1-3-5-7/h7-8,10H,1-6,9H2/t8-/m1/s1
SMILES:C1CCC(CC1)[C@@H](CO)N
Synonyms:- (2S)-2-Amino-2-cyclohexylethanol
- (S)-2-Amino-2-cyclohexyl-ethanol
- cyclohexaneethanol, β-amino-, (betaS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
