CAS 84558-03-2

2-[4-(propan-2-yl)phenyl]ethanamine

Description:

2-[4-(Propan-2-yl)phenyl]ethanamine, also known as a substituted phenethylamine, is a chemical compound characterized by its amine functional group and a branched alkyl substituent. It features a phenyl ring with an isopropyl group attached to the para position, which contributes to its hydrophobic properties. The presence of the ethanamine moiety indicates that it has a two-carbon chain linking the amine group to the aromatic system. This compound may exhibit biological activity, potentially interacting with neurotransmitter systems due to its structural similarity to other amines. Its molecular structure suggests it could be lipophilic, influencing its solubility and permeability in biological membranes. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would depend on the specific arrangement of its atoms and the presence of functional groups. As with many amines, it may also participate in hydrogen bonding, affecting its interactions in various chemical environments. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₁H₁₇N

InChI: InChI=1/C11H17N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7-8,12H2,1-2H3

Synonyms:

• 2-[4-(propan-2-yl)phenyl]ethanaminium
• 4-Isopropylphenethylamine
• 4-Isopropylphenethylamine hydrochloride

Benzeneethanamine,4-(1-methylethyl)-

CAS: 84558-03-2

Formula: C₁₁H₁₇N

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.2594

Ref: IN-DA0052N5

2-(4-Isopropylphenyl)ethanamine

Controlled Product

CAS: 84558-03-2

Versatile small molecule scaffold

Formula: C₁₁H₁₇N

Purity: Min. 95%

Molecular weight: 163.26 g/mol

Ref: 3D-JDA55803