CAS 845616-55-9
:4-(Piperazin-1-yl)-6-(trifluoromethyl)pyrimidine
Description:
4-(Piperazin-1-yl)-6-(trifluoromethyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a piperazine group at the 4-position introduces a secondary amine functionality, enhancing its potential for biological activity and interaction with various receptors. The trifluoromethyl group at the 6-position significantly influences the compound's lipophilicity and electronic properties, often enhancing its potency and selectivity in pharmacological applications. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases, including cancer and neurological disorders. Its unique structural features contribute to its potential as a lead compound in drug discovery, making it a subject of research in both synthetic and medicinal chemistry. As with many fluorinated compounds, it may exhibit distinct solubility and stability characteristics, which are important for its application in biological systems.
Formula:C9H11F3N4
InChI:InChI=1/C9H11F3N4/c10-9(11,12)7-5-8(15-6-14-7)16-3-1-13-2-4-16/h5-6,13H,1-4H2
SMILES:C1CN(CCN1)c1cc(C(F)(F)F)ncn1
Synonyms:- 4-(1-Piperazinyl)-6-(trifluoromethyl)pyrimidine
- Pyrimidine, 4-(1-Piperazinyl)-6-(Trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
