CAS 845617-33-6
:1-(6-Methyl-3-pyridinyl)piperazine
Description:
1-(6-Methyl-3-pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 6-methyl-3-pyridinyl group indicates that a pyridine ring is substituted at the 3-position with a methyl group, contributing to its unique properties. This compound is typically classified as a heterocyclic amine and may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with biological targets, which can influence its pharmacokinetic and pharmacodynamic profiles. The compound is likely to be soluble in polar solvents due to the presence of nitrogen atoms, which can participate in hydrogen bonding. Additionally, its specific stereochemistry and functional groups can affect its reactivity and interactions with other molecules. As with many piperazine derivatives, it may be investigated for its potential therapeutic applications, including in the treatment of neurological or psychiatric disorders.
Formula:C10H15N3
InChI:InChI=1S/C10H15N3/c1-9-2-3-10(8-12-9)13-6-4-11-5-7-13/h2-3,8,11H,4-7H2,1H3
InChI key:InChIKey=OQQGPLUJVKMDEB-UHFFFAOYSA-N
SMILES:CC=1C=CC(=CN1)N2CCNCC2
Synonyms:- 1-(2-Methylpyridin-5-yl)piperazine
- 1-(6-Methyl-3-pyridinyl)piperazine
- 1-(6-Methylpyridin-3-yl)piperazine
- Piperazine, 1-(6-methyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.