CAS 845626-18-8

1-Propanesulfonamide, N-4-piperidinyl-, hydrochloride (1:1)

Description:

1-Propanesulfonamide, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a piperidine ring, contributing to its potential biological activity, particularly in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the propanesulfonamide moiety suggests that it may interact with biological targets through hydrogen bonding and other non-covalent interactions. This compound may exhibit properties such as moderate stability under standard conditions, and its solubility profile can be influenced by pH. Additionally, it may have implications in drug design, particularly in the development of therapeutics targeting various diseases. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₈H₁₈N₂O₂S·ClH

InChI: InChI=1S/C8H18N2O2S.ClH/c1-2-7-13(11,12)10-8-3-5-9-6-4-8;/h8-10H,2-7H2,1H3;1H

InChI key: InChIKey=UHMWJNWPTQGTRQ-UHFFFAOYSA-N

SMILES: N(S(CCC)(=O)=O)C1CCNCC1.Cl

Synonyms:

• 1-Propanesulfonamide, N-4-piperidinyl-, hydrochloride (1:1)
• 1-Propanesulfonamide, N-4-piperidinyl-, monohydrochloride