CAS 845714-00-3: 2-pyridin-4-yl-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one hydrochloride
Description:2-Pyridin-4-yl-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes both pyridine and pyrrolo moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the pyridine ring suggests it may engage in hydrogen bonding and participate in various chemical reactions, while the tetrahydro-pyrrolo structure contributes to its overall stability and solubility. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit specific pharmacological properties, potentially acting as an inhibitor or modulator in biological systems, although detailed studies would be necessary to elucidate its exact mechanisms of action. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C12H12ClN3O
InChI:InChI=1/C12H11N3O.ClH/c16-12-9-7-11(8-1-4-13-5-2-8)15-10(9)3-6-14-12;/h1-2,4-5,7,15H,3,6H2,(H,14,16);1H