CAS 845714-30-9

L-Cyclohexylglycinol

Description:

L-Cyclohexylglycinol is an organic compound characterized by its cyclohexyl group attached to a glycine moiety. It is classified as an amino alcohol, which means it contains both an amino group (-NH2) and a hydroxyl group (-OH) in its structure. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its hydrophilic nature due to the presence of the amino and hydroxyl groups. L-Cyclohexylglycinol has garnered interest in various fields, including medicinal chemistry, due to its potential biological activities, such as neuroprotective effects and modulation of neurotransmitter systems. Its structural features allow it to interact with biological targets, making it a subject of research in pharmacology. Additionally, the cyclohexyl group contributes to its lipophilicity, which can influence its pharmacokinetic properties. Overall, L-Cyclohexylglycinol represents a unique compound with potential applications in drug development and therapeutic interventions.

Formula: C₈H₁₇NO

InChI: InChI=1S/C8H17NO/c9-8(6-10)7-4-2-1-3-5-7/h7-8,10H,1-6,9H2/t8-/m1/s1

SMILES: C1CCC(CC1)[C@@H](CO)N

Synonyms:

• (S)-2-Amino-2-cyclohexylethanol
• (S)-Cyclohexylglycinol
• (S)-2-Amino-2-cyclohexyl-ethanol
• (2S)-2-Amino-2-cyclohexylethanol
• cyclohexaneethanol, β-amino-, (βS)-

(S)-2-Amino-2-cyclohexylethanol

CAS: 845714-30-9

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.2267

Ref: IN-DA0039X6

(S)-2-Amino-2-cyclohexylethanol

CAS: 845714-30-9

(S)-2-Amino-2-cyclohexylethanol

Purity: 97%

Molecular weight: 143.23g/mol

Ref: 54-OR90415

(S)-2-Amino-2-cyclohexylethanol

CAS: 845714-30-9

Formula: C₈H₁₇NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 143.23

Ref: 10-F229936

(S)-2-Amino-2-cyclohexylethanol

CAS: 845714-30-9

Versatile small molecule scaffold

Formula: C₈H₁₇NO

Purity: Min. 95%

Molecular weight: 143.23 g/mol

Ref: 3D-VIB71430