CAS 84573-33-1
:(-)-Quinocarcin
Description:
(-)-Quinocarcin is a naturally occurring anthracycline antibiotic with notable antitumor properties. It is derived from the bacterium *Micromonospora* and is characterized by its complex polycyclic structure, which includes a quinone moiety. This compound exhibits a unique mechanism of action, primarily through intercalation into DNA, leading to the inhibition of topoisomerase II and subsequent disruption of DNA replication and transcription. (-)-Quinocarcin is known for its cytotoxic effects against various cancer cell lines, making it a subject of interest in cancer research. Its stereochemistry, indicated by the prefix "(-)", denotes its specific optical activity, which can influence its biological interactions and efficacy. Additionally, (-)-Quinocarcin has been studied for its potential in combination therapies, enhancing the effectiveness of other chemotherapeutic agents. However, like many anthracyclines, it may also exhibit dose-dependent side effects, including cardiotoxicity, necessitating careful consideration in therapeutic applications. Overall, (-)-Quinocarcin represents a significant compound in the field of medicinal chemistry and oncology.
Formula:C18H22N2O4
InChI:InChI=1S/C18H22N2O4/c1-19-12-7-10(18(21)22)16(19)11-6-9-4-3-5-14(23-2)15(9)13-8-24-17(12)20(11)13/h3-5,10-13,16-17H,6-8H2,1-2H3,(H,21,22)/t10-,11+,12+,13+,16-,17-/m1/s1
InChI key:InChIKey=VOUMVHRRAVBACH-RXCQEBQVSA-N
SMILES:C(O)(=O)[C@H]1[C@@]2([C@]3(N4[C@](C=5C(C3)=CC=CC5OC)(CO[C@@]4([C@@](N2C)(C1)[H])[H])[H])[H])[H]
Synonyms:- (-)-Quinocarcin
- (2aR,3S,5R,6R,6aS,11bR)-2a,3,4,5,6,6a,7,11b-Octahydro-11-methoxy-12-methyl-3,6-imino-1H-2-oxa-11c-azanaphth[1,2,3-cd]azulene-5-carboxylic acid
- 3,6-Imino-1H-2-oxa-11c-azanaphth[1,2,3-cd]azulene-5-carboxylic acid, 2a,3,4,5,6,6a,7,11b-octahydro-11-methoxy-12-methyl-, (2aR,3S,5R,6R,6aS,11bR)-
- 3,6-Imino-1H-2-oxa-11c-azanaphth[1,2,3-cd]azulene-5-carboxylic acid, 2a,3,4,5,6,6a,7,11b-octahydro-11-methoxy-12-methyl-, [2aR-(2aα,3α,5α,6α,6aα,11bα)]-
- Antibiotic DC 52
- Dc-52
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(-)-Quinocarcin
CAS:Controlled Product<p>Applications (-)-Quinocarcin are potent antitumor antibiotics that plays a key role in the construction of tetracyclic THIQ-pyrrolidine core scaffold.<br>References Hiratsuka, T., et al.: Chem. Biol., 20, 1523-1535 (2013)<br></p>Formula:C18H22N2O4Color and Shape:NeatMolecular weight:330.378Quinocarcin
CAS:<p>Quinocarcin is an antitumor antibiotic, which is a potent chemical compound derived from the bacterium Streptomyces. This compound exhibits its mode of action through interaction with DNA, where it induces DNA cross-linking and inhibits DNA replication, ultimately leading to cell death. The mechanism makes it particularly effective as a cytotoxic agent against rapidly dividing cancer cells.</p>Formula:C18H22N2O4Purity:Min. 95%Molecular weight:330.4 g/mol

