
CAS 845775-45-3
:N-4-Piperidinyl-1-propanesulfonamide
Description:
N-4-Piperidinyl-1-propanesulfonamide, identified by its CAS number 845775-45-3, is a chemical compound characterized by its sulfonamide functional group attached to a piperidine ring and a propyl chain. This compound typically exhibits properties associated with sulfonamides, such as potential antimicrobial activity, due to the presence of the sulfonamide moiety. The piperidine ring contributes to its structural rigidity and may influence its interaction with biological targets. The compound is likely to be soluble in polar solvents, given the presence of the sulfonamide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the compound's stability and reactivity can be influenced by the substituents on the piperidine and propyl groups, making it a subject of interest for further research in drug design and synthesis. As with many sulfonamides, safety and toxicity profiles should be evaluated in the context of its intended use.
Formula:C8H18N2O2S
InChI:InChI=1S/C8H18N2O2S/c1-2-7-13(11,12)10-8-3-5-9-6-4-8/h8-10H,2-7H2,1H3
InChI key:InChIKey=HMFFHCKOIQTSMA-UHFFFAOYSA-N
SMILES:N(S(CCC)(=O)=O)C1CCNCC1
Synonyms:- 1-Propanesulfonamide, N-4-piperidinyl-
- N-4-Piperidinyl-1-propanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.