CAS 845781-05-7

(3,5-dichlorophenyl)(3,4-difluorophenyl)methanone

Description:

(3,5-Dichlorophenyl)(3,4-difluorophenyl)methanone, identified by its CAS number 845781-05-7, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, which is indicated by the presence of the methanone moiety, and is substituted with two distinct aromatic rings. One ring contains two chlorine atoms at the 3 and 5 positions, while the other ring has two fluorine atoms at the 3 and 4 positions. This substitution pattern contributes to the compound's unique electronic properties and potential reactivity. The presence of halogens, such as chlorine and fluorine, often enhances the lipophilicity and stability of the compound, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's molecular structure may influence its biological activity, making it a candidate for further research in medicinal chemistry. Overall, (3,5-dichlorophenyl)(3,4-difluorophenyl)methanone exemplifies the intricate relationship between molecular structure and chemical behavior.

Formula: C₁₃H₆Cl₂F₂O

InChI: InChI=1/C13H6Cl2F2O/c14-9-3-8(4-10(15)6-9)13(18)7-1-2-11(16)12(17)5-7/h1-6H

SMILES: c1cc(c(cc1C(=O)c1cc(cc(c1)Cl)Cl)F)F

Synonyms:

• Methanone, (3,5-dichlorophenyl)(3,4-difluorophenyl)-
• (3,5-Dichlorophenyl)(3,4-difluorophenyl)methanone