CAS 845781-08-0
:(3,4-difluorophenyl)(4-methoxy-3,5-dimethylphenyl)methanone
Description:
The chemical substance known as (3,4-difluorophenyl)(4-methoxy-3,5-dimethylphenyl)methanone, with the CAS number 845781-08-0, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of two aromatic rings: one bearing two fluorine substituents and the other containing a methoxy group and two methyl groups. The presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of the compound, which can influence its biological activity. The methoxy group is known to enhance solubility and can also affect the electronic properties of the molecule. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical interactions. Additionally, the compound's unique combination of substituents may contribute to its specificity and potency in biological systems, making it a subject of interest for further research and development.
Formula:C16H14F2O2
InChI:InChI=1/C16H14F2O2/c1-9-6-12(7-10(2)16(9)20-3)15(19)11-4-5-13(17)14(18)8-11/h4-8H,1-3H3
SMILES:Cc1cc(cc(C)c1OC)C(=O)c1ccc(c(c1)F)F
Synonyms:- Methanone, (3,4-difluorophenyl)(4-methoxy-3,5-dimethylphenyl)-
- (3,4-Difluorophenyl)(4-methoxy-3,5-dimethylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.