CAS 845781-10-4

(3,4-difluorophenyl)[4-(ethylsulfanyl)phenyl]methanone

Description:

(3,4-Difluorophenyl)[4-(ethylsulfanyl)phenyl]methanone, with the CAS number 845781-10-4, is an organic compound characterized by its complex structure, which includes a ketone functional group and two aromatic rings. The presence of fluorine atoms on the phenyl ring enhances its electronic properties, potentially increasing its reactivity and influencing its interactions with biological targets. The ethylsulfanyl group introduces a sulfur atom, which can impart unique chemical properties, such as increased lipophilicity and potential for forming various interactions in biological systems. This compound may exhibit interesting pharmacological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, the characteristics of this compound suggest potential applications in drug development and materials science, warranting further investigation into its properties and behavior in different chemical contexts.

Formula: C₁₅H₁₂F₂OS

InChI: InChI=1/C15H12F2OS/c1-2-19-12-6-3-10(4-7-12)15(18)11-5-8-13(16)14(17)9-11/h3-9H,2H2,1H3

SMILES: CCSc1ccc(cc1)C(=O)c1ccc(c(c1)F)F

Synonyms:

• Methanone, (3,4-difluorophenyl)[4-(ethylthio)phenyl]-