CAS 845781-21-7
:1-(3-Chloro-5-fluorophenyl)-2-phenylethanone
Description:
1-(3-Chloro-5-fluorophenyl)-2-phenylethanone, with the CAS number 845781-21-7, is an organic compound characterized by its ketone functional group and aromatic structure. It features a phenyl group attached to a carbonyl (C=O) moiety, which is further substituted with a 3-chloro-5-fluorophenyl group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic rings. The presence of chlorine and fluorine substituents can influence its reactivity and polarity, potentially enhancing its biological activity or interaction with other chemical species. As a ketone, it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C14H10ClFO
InChI:InChI=1S/C14H10ClFO/c15-12-7-11(8-13(16)9-12)14(17)6-10-4-2-1-3-5-10/h1-5,7-9H,6H2
InChI key:InChIKey=JYPKPMJHTOUUBX-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)(=O)C2=CC(Cl)=CC(F)=C2
Synonyms:- Ethanone, 1-(3-chloro-5-fluorophenyl)-2-phenyl-
- 3′-Chloro-5′-fluoro-2-phenylacetophenone
- 1-(3-Chloro-5-fluorophenyl)-2-phenylethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.