CAS 845781-23-9

1-(4-Chloro-3-fluorophenyl)-2-phenylethanone

Description:

1-(4-Chloro-3-fluorophenyl)-2-phenylethanone, with the CAS number 845781-23-9, is an organic compound characterized by its ketone functional group and aromatic structure. This compound features a phenyl group attached to a carbonyl (C=O) moiety, indicating its classification as a ketone. The presence of a 4-chloro and a 3-fluoro substituent on the phenyl ring contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. The chlorinated and fluorinated substituents can enhance lipophilicity and alter the electronic properties of the molecule, which may affect its behavior in various chemical reactions or applications. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can improve efficacy or selectivity. As with many organic compounds, safety and handling precautions should be observed, as the presence of halogens may introduce toxicity or environmental concerns. Overall, this compound exemplifies the complexity and versatility of aromatic ketones in organic chemistry.

Formula: C₁₄H₁₀ClFO

InChI: InChI=1S/C14H10ClFO/c15-12-7-6-11(9-13(12)16)14(17)8-10-4-2-1-3-5-10/h1-7,9H,8H2

InChI key: InChIKey=JETGOFXNIJXWJC-UHFFFAOYSA-N

SMILES: C(CC1=CC=CC=C1)(=O)C2=CC(F)=C(Cl)C=C2

Synonyms:

• 1-(4-Chloro-3-fluorophenyl)-2-phenylethanone
• Ethanone, 1-(4-chloro-3-fluorophenyl)-2-phenyl-