CAS 845781-34-2
:5-(3-methoxyphenyl)-5-oxopentanoic acid
Description:
5-(3-Methoxyphenyl)-5-oxopentanoic acid, identified by its CAS number 845781-34-2, is an organic compound characterized by its unique structure, which includes a pentanoic acid backbone with a ketone and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications. The presence of the carboxylic acid group contributes to its acidity, while the methoxy group can influence its solubility and reactivity. Additionally, the aromatic ring may provide stability and facilitate interactions in biological systems or chemical reactions. The compound's molecular structure suggests it could participate in hydrogen bonding, affecting its physical properties such as melting point and solubility in polar solvents. Overall, 5-(3-methoxyphenyl)-5-oxopentanoic acid is of interest in fields such as medicinal chemistry and organic synthesis, where its unique characteristics may be leveraged for the development of pharmaceuticals or other chemical products.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-16-10-5-2-4-9(8-10)11(13)6-3-7-12(14)15/h2,4-5,8H,3,6-7H2,1H3,(H,14,15)
SMILES:COc1cccc(c1)C(=O)CCCC(=O)O
Synonyms:- Benzenepentanoic acid, 3-methoxy-delta-oxo-
- 5-(3-Methoxyphenyl)-5-oxopentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.