CAS 845781-37-5

5-(3,5-dimethylphenyl)-3-methyl-5-oxopentanoic acid

Description:

5-(3,5-Dimethylphenyl)-3-methyl-5-oxopentanoic acid, identified by its CAS number 845781-37-5, is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone with ketone and aromatic substituents. This compound features a 3,5-dimethylphenyl group, contributing to its hydrophobic characteristics, and a carboxylic acid functional group, which imparts acidic properties. The presence of the ketone group enhances its reactivity, making it a potential intermediate in organic synthesis. Its molecular structure suggests it may exhibit interesting biological activities, although specific biological data may vary. The compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic aromatic component. As with many organic acids, it may participate in various chemical reactions, including esterification and acylation. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₄H₁₈O₃

InChI: InChI=1/C14H18O3/c1-9-4-10(2)6-12(5-9)13(15)7-11(3)8-14(16)17/h4-6,11H,7-8H2,1-3H3,(H,16,17)

SMILES: Cc1cc(C)cc(c1)C(=O)CC(C)CC(=O)O

Synonyms:

• Benzenepentanoic acid, beta,3,5-trimethyl-delta-oxo-