CAS 845781-51-3

5-(4-chloro-3-methylphenyl)-3-methyl-5-oxopentanoic acid

Description:

5-(4-chloro-3-methylphenyl)-3-methyl-5-oxopentanoic acid is an organic compound characterized by its complex structure, which includes a pentanoic acid backbone substituted with a chloro and methyl group on the aromatic ring. This compound features a ketone functional group, indicated by the "5-oxo" designation, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloro group enhances its electrophilic character, making it useful in various chemical reactions. Additionally, the methyl groups provide steric hindrance, which can influence the compound's reactivity and interaction with biological systems. The compound's acid functionality suggests it may exhibit acidic properties, potentially allowing it to participate in acid-base reactions. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific properties, such as solubility and stability, would depend on the surrounding conditions and the presence of other functional groups in a given reaction environment.

Formula: C₁₃H₁₅ClO₃

InChI: InChI=1/C13H15ClO3/c1-8(6-13(16)17)5-12(15)10-3-4-11(14)9(2)7-10/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)

SMILES: CC(CC(=O)c1ccc(c(C)c1)Cl)CC(=O)O

Synonyms:

• Benzenepentanoic acid, 4-chloro-beta,3-dimethyl-delta-oxo-
• 5-(4-Chloro-3-methylphenyl)-3-methyl-5-oxopentanoic acid