CymitQuimica logo

CAS 845781-52-4

:

5-Chloro-β-methyl-δ-oxo-2-thiophenepentanoic acid

Description:
5-Chloro-β-methyl-δ-oxo-2-thiophenepentanoic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring and a pentanoic acid backbone. The presence of a chlorine atom at the 5-position and a β-methyl group contributes to its distinct reactivity and potential biological activity. The δ-oxo functional group indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may exhibit properties typical of both carboxylic acids and thiophene derivatives, such as solubility in organic solvents and potential interactions with biological targets. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Additionally, the presence of halogens and functional groups can influence the compound's stability, reactivity, and interaction with other molecules, making it a subject of interest in synthetic and pharmaceutical chemistry.
Formula:C10H11ClO3S
InChI:InChI=1/C10H11ClO3S/c1-6(5-10(13)14)4-7(12)8-2-3-9(11)15-8/h2-3,6H,4-5H2,1H3,(H,13,14)
InChI key:InChIKey=KIXMFCURAYYUCO-UHFFFAOYSA-N
SMILES:C(CC(CC(O)=O)C)(=O)C=1SC(Cl)=CC1
Synonyms:
  • 2-Thiophenepentanoic acid, 5-chloro-beta-methyl-delta-oxo-
  • 2-Thiophenepentanoic acid, 5-chloro-β-methyl-δ-oxo-
  • 5-(5-Chloro-2-thienyl)-3-methyl-5-oxopentanoic acid
  • 5-Chloro-β-methyl-δ-oxo-2-thiophenepentanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.