CAS 845781-54-6

2,3-Dihydro-δ-oxo-1,4-benzodioxin-6-pentanoic acid

Description:

2,3-Dihydro-δ-oxo-1,4-benzodioxin-6-pentanoic acid, with the CAS number 845781-54-6, is a chemical compound that features a unique bicyclic structure characterized by a benzodioxin moiety. This compound typically exhibits properties associated with both carboxylic acids and diketones, which may influence its reactivity and potential applications. The presence of the dioxin ring suggests that it may participate in various chemical reactions, including electrophilic substitutions or nucleophilic attacks, depending on the functional groups present. Its pentanoic acid side chain contributes to its solubility and potential interactions in biological systems. The compound may be of interest in medicinal chemistry or materials science due to its structural features, which could lead to specific biological activities or functionalities. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses. As with any chemical, proper handling and safety measures should be observed when working with this substance.

Formula: C₁₃H₁₄O₅

InChI: InChI=1S/C13H14O5/c14-10(2-1-3-13(15)16)9-4-5-11-12(8-9)18-7-6-17-11/h4-5,8H,1-3,6-7H2,(H,15,16)

InChI key: InChIKey=SZCDSMJFYQLPCC-UHFFFAOYSA-N

SMILES: C(CCCC(O)=O)(=O)C=1C=C2C(=CC1)OCCO2

Synonyms:

• 1,4-Benzodioxin-6-pentanoic acid, 2,3-dihydro-delta-oxo-
• 1,4-Benzodioxin-6-pentanoic acid, 2,3-dihydro-δ-oxo-
• 2,3-Dihydro-δ-oxo-1,4-benzodioxin-6-pentanoic acid
• 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-5-oxopentanoic acid

5-[3,4-(Ethylenedioxy)phenyl]-5-oxovaleric acid

CAS: 845781-54-6

Formula: C₁₃H₁₄O₅

Purity: 95.0%

Molecular weight: 250.25

Ref: 10-F022950