CAS 845822-99-3

3′-Fluoro[1,1′-biphenyl]-3-thiol

Description:

3′-Fluoro[1,1′-biphenyl]-3-thiol, with the CAS number 845822-99-3, is an organosulfur compound characterized by the presence of a thiol (-SH) group and a fluorine atom attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, with the fluorine substituent located at the 3′ position of one of the rings and the thiol group at the 3 position of the biphenyl system. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. The thiol group contributes to the compound's ability to form hydrogen bonds and participate in redox reactions, making it useful in various chemical applications, including organic synthesis and materials science. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Overall, 3′-Fluoro[1,1′-biphenyl]-3-thiol is a versatile compound with potential applications in both research and industry.

Formula: C₁₂H₉FS

InChI: InChI=1S/C12H9FS/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8,14H

InChI key: InChIKey=LTZFHSPKQIITEU-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1)C2=CC(S)=CC=C2

Synonyms:

• 3′-Fluoro[1,1′-biphenyl]-3-thiol
• [1,1′-Biphenyl]-3-thiol, 3′-fluoro-