CAS 845823-16-7
:2-Fluoro-1-methyl-4-(trimethylsilyl)benzene
Description:
2-Fluoro-1-methyl-4-(trimethylsilyl)benzene, with the CAS number 845823-16-7, is an organofluorine compound characterized by the presence of a fluorine atom, a methyl group, and a trimethylsilyl group attached to a benzene ring. The fluorine atom is located at the second position, while the methyl and trimethylsilyl groups are positioned at the first and fourth positions, respectively. This compound exhibits properties typical of aromatic hydrocarbons, including stability and a tendency to participate in electrophilic substitution reactions. The trimethylsilyl group enhances the compound's solubility in organic solvents and can influence its reactivity, making it useful in various synthetic applications. Additionally, the presence of the fluorine atom can impart unique electronic properties, potentially affecting the compound's behavior in chemical reactions and interactions with other substances. Overall, 2-Fluoro-1-methyl-4-(trimethylsilyl)benzene serves as a valuable intermediate in organic synthesis and materials science.
Formula:C10H15FSi
InChI:InChI=1S/C10H15FSi/c1-8-5-6-9(7-10(8)11)12(2,3)4/h5-7H,1-4H3
InChI key:InChIKey=HVLNEPZCGKNYTC-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C)C1=CC(F)=C(C)C=C1
Synonyms:- Silane, (3-fluoro-4-methylphenyl)trimethyl-
- 2-Fluoro-1-methyl-4-(trimethylsilyl)benzene
- Benzene, 2-fluoro-1-methyl-4-(trimethylsilyl)-
- 1-(TRIMETHYLSILYL)-3-FLUORO-4-METHYLBENZENE
- 4-(TRIMETHYLSILYL)-2-FLUOROTOLUENE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.