CAS 845826-92-8
:4-(5-Methyl-2-pyridinyl)benzoic acid
Description:
4-(5-Methyl-2-pyridinyl)benzoic acid, identified by its CAS number 845826-92-8, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and a pyridine ring substituted with a methyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylic acid functional group. The pyridine ring contributes to its basicity and potential for hydrogen bonding, influencing its reactivity and interactions in various chemical environments. It may also display biological activity, making it of interest in pharmaceutical research. The compound's melting point, boiling point, and specific reactivity would depend on its purity and the conditions under which it is studied. Overall, 4-(5-Methyl-2-pyridinyl)benzoic acid serves as a valuable building block in organic synthesis and medicinal chemistry, with applications that may extend to agrochemicals and materials science.
Formula:C13H11NO2
InChI:InChI=1S/C13H11NO2/c1-9-2-7-12(14-8-9)10-3-5-11(6-4-10)13(15)16/h2-8H,1H3,(H,15,16)
InChI key:InChIKey=DYFJYHZDJPICHF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C=C1)C2=CC=C(C)C=N2
Synonyms:- 4-(5-Methylpyridin-2-Yl)Benzoic Acid
- Benzoic Acid, 4-(5-Methyl-2-Pyridinyl)-
- 4-(5-Methyl-2-pyridinyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
