CAS 845827-15-8

[2,3′-Bipyridine]-6′-carboxylic acid, methyl ester

Description:

[2,3′-Bipyridine]-6′-carboxylic acid, methyl ester is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of the bipyridine moiety imparts unique electronic properties, making it useful in coordination chemistry and as a ligand in metal complexes. The methyl ester group enhances its solubility in organic solvents, facilitating its application in various chemical reactions and syntheses. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 845827-15-8, allows for easy identification and retrieval of information in chemical databases. Overall, [2,3′-Bipyridine]-6′-carboxylic acid, methyl ester is a versatile compound with potential applications in both research and industry, particularly in the fields of organic synthesis and materials science.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c1-16-12(15)11-6-5-9(8-14-11)10-4-2-3-7-13-10/h2-8H,1H3

InChI key: InChIKey=NDHHMOUAQBVFNB-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=CC(=CN1)C2=CC=CC=N2

Synonyms:

• Methyl 2,3′-bipyridine-6′-carboxylate
• [2,3′-Bipyridine]-6′-carboxylic acid, methyl ester

Methyl [2,3'-bipyridine]-6'-carboxylate

CAS: 845827-15-8

Formula: C₁₂H₁₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 214.2200

Ref: IN-DA01FS2Y

Methyl [2,3'-bipyridine]-6'-carboxylate

CAS: 845827-15-8

Methyl [2,3'-bipyridine]-6'-carboxylate

Purity: 95%

Molecular weight: 214.22g/mol

Ref: 54-OR1051085