CAS 845866-51-5

1-[4-(2-Bromo-4-fluorophenoxy)phenyl]ethanone

Description:

1-[4-(2-Bromo-4-fluorophenoxy)phenyl]ethanone, with the CAS number 845866-51-5, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a bromine and fluorine atom, as well as an ethanone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and the potential for various chemical reactions, including electrophilic substitutions. The presence of halogen substituents (bromine and fluorine) can influence its reactivity and polarity, making it useful in various synthetic applications. Additionally, the ethanone moiety contributes to its ketone characteristics, which may affect its solubility and interaction with other chemical species. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could impart specific biological activities or physical properties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose health risks.

Formula: C₁₄H₁₀BrFO₂

InChI: InChI=1S/C14H10BrFO2/c1-9(17)10-2-5-12(6-3-10)18-14-7-4-11(16)8-13(14)15/h2-8H,1H3

InChI key: InChIKey=DYMTWGSDROBNOQ-UHFFFAOYSA-N

SMILES: O(C1=C(Br)C=C(F)C=C1)C2=CC=C(C(C)=O)C=C2

Synonyms:

• 1-[4-(2-Bromo-4-fluorophenoxy)phenyl]ethanone
• Ethanone, 1-[4-(2-bromo-4-fluorophenoxy)phenyl]-
• 1-(4-(2-Bromo-4-fluorophenoxy)phenyl)ethanone

4′-(2-Bromo-4-fluorophenoxy)acetophenone

CAS: 845866-51-5

Formula: C₁₄H₁₀BrFO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 309.134

Ref: 10-F023247