CAS 845866-52-6

1-Bromo-3-[(4-fluorophenyl)methoxy]benzene

Description:

1-Bromo-3-[(4-fluorophenyl)methoxy]benzene, with the CAS number 845866-52-6, is an organic compound characterized by the presence of a bromine atom and a methoxy group attached to a benzene ring. This compound features a bromo substituent at the 1-position and a methoxy group linked to a 4-fluorophenyl moiety at the 3-position of the benzene ring. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The fluorine atom in the para position can influence the electronic properties of the molecule, potentially enhancing its lipophilicity and affecting its biological activity. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Additionally, its physical properties, such as solubility and melting point, would be influenced by the substituents on the benzene ring, which can affect its interactions in various chemical environments.

Formula: C₁₃H₁₀BrFO

InChI: InChI=1S/C13H10BrFO/c14-11-2-1-3-13(8-11)16-9-10-4-6-12(15)7-5-10/h1-8H,9H2

InChI key: InChIKey=XDWVGNILIVLUOR-UHFFFAOYSA-N

SMILES: C(OC1=CC(Br)=CC=C1)C2=CC=C(F)C=C2

Synonyms:

• Benzene, 1-bromo-3-[(4-fluorophenyl)methoxy]-
• 1-Bromo-3-[(4-fluorophenyl)methoxy]benzene
• 1-(3-Bromophenoxymethyl)-4-fluorobenzene

3-Bromophenyl-(4-fluorobenzyl)ether

CAS: 845866-52-6

Formula: C₁₃H₁₀BrFO

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 281.124

Ref: 10-F023248