CAS 845866-53-7

1-[(3-Bromophenoxy)methyl]-2-methylbenzene

Description:

1-[(3-Bromophenoxy)methyl]-2-methylbenzene, also known by its CAS number 845866-53-7, is an organic compound characterized by its aromatic structure. It features a bromophenyl group attached to a methylene bridge, which is further connected to a methyl-substituted benzene ring. This compound exhibits properties typical of aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The presence of the bromine atom introduces both electronegative character and potential for further chemical reactivity, such as nucleophilic substitution. The methoxy group enhances solubility in organic solvents and may influence the compound's reactivity and interaction with biological systems. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, as they can vary based on purity and environmental conditions. Overall, this compound represents a versatile structure within the realm of organic chemistry.

Formula: C₁₄H₁₃BrO

InChI: InChI=1S/C14H13BrO/c1-11-5-2-3-6-12(11)10-16-14-8-4-7-13(15)9-14/h2-9H,10H2,1H3

InChI key: InChIKey=ACGIUZUOTBCQHD-UHFFFAOYSA-N

SMILES: C(OC1=CC(Br)=CC=C1)C2=C(C)C=CC=C2

Synonyms:

• Benzene, 1-[(3-bromophenoxy)methyl]-2-methyl-
• 1-[(3-Bromophenoxy)methyl]-2-methylbenzene

3-Bromophenyl-(2-methylbenzyl)ether

CAS: 845866-53-7

Formula: C₁₄H₁₃BrO

Purity: 97.0%

Molecular weight: 277.161

Ref: 10-F023256