CAS 845866-87-7
:2-Thiophenecarboximidamide, N-hydroxy-4-methyl-
Description:
2-Thiophenecarboximidamide, N-hydroxy-4-methyl- is a chemical compound characterized by its unique structure, which includes a thiophene ring and an amidine functional group. The presence of the N-hydroxy substituent adds to its reactivity and potential biological activity. This compound may exhibit properties typical of thiophene derivatives, such as aromaticity and the ability to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its specific applications can vary, but compounds of this nature are often explored in medicinal chemistry for their potential as pharmaceuticals or agrochemicals. The molecular interactions and stability of this compound can be influenced by the presence of the hydroxyl group, which may enhance solubility and reactivity. Additionally, the methyl group on the thiophene ring can affect the electronic properties and steric hindrance, influencing how the compound interacts with biological targets. Overall, 2-Thiophenecarboximidamide, N-hydroxy-4-methyl- represents a class of compounds with diverse potential applications in chemical and pharmaceutical research.
Formula:C6H8N2OS
InChI:InChI=1S/C6H8N2OS/c1-4-2-5(10-3-4)6(7)8-9/h2-3,9H,1H3,(H2,7,8)
InChI key:InChIKey=WVQRUVXWKVOMEJ-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1=CC(C)=CS1
Synonyms:- N-Hydroxy-4-methyl-2-thiophenecarboximidamide
- 2-Thiophenecarboximidamide, N-hydroxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
