CAS 845866-92-4
:6-Amino-3-bromo-2-fluorobenzonitrile
Description:
6-Amino-3-bromo-2-fluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a bromine atom, and a fluorine atom, along with a nitrile functional group. The presence of the amino group (-NH2) indicates potential for hydrogen bonding and reactivity in various chemical reactions, while the bromine and fluorine substituents contribute to the compound's electrophilic character and influence its physical properties, such as solubility and boiling point. The nitrile group (-C≡N) adds to the compound's polarity and can participate in nucleophilic addition reactions. This compound is typically used in pharmaceutical research and development due to its potential biological activity. Its unique combination of halogen and amino functionalities makes it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-5-1-2-6(11)4(3-10)7(5)9/h1-2H,11H2
SMILES:c1cc(c(C#N)c(c1Br)F)N
Synonyms:- 4-Bromo-2-cyano-3-fluoroaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-AMino-3-broMo-2-fluoro-benzonitrile
CAS:Formula:C7H4BrFN2Purity:96%Color and Shape:SolidMolecular weight:215.02256-Amino-3-bromo-2-fluorobenzonitrile
CAS:6-Amino-3-bromo-2-fluorobenzonitrileFormula:C7H4BrFN2Purity:95%Color and Shape: off white crystalline solidMolecular weight:215.02g/mol2-Amino-5-bromo-6-fluorobenzonitrile
CAS:Formula:C7H4BrFN2Purity:96%Color and Shape:SolidMolecular weight:215.0252-Cyano-3-fluoro-4-bromo aniline
CAS:2-Cyano-3-fluoro-4-bromo aniline is a plant growth regulator that can be used to prevent and control the spread of viral diseases in plants. 2-Cyano-3-fluoro-4-bromo aniline inhibits the replication of influenza virus strains by binding to the viral coat protein. It also has been shown to inhibit proteolytic enzymes when applied as a coating on particles. The main mechanism of this compound is through its ability to bind to regulatory proteins, which prevents them from binding with other regulatory proteins and activating transcription factors. The expression profile suggests that this compound may regulate the expression of genes involved in plant development, cell division, and response to stress.
Formula:C7H4BrFN2Purity:Min. 95%Color and Shape:PowderMolecular weight:215.02 g/molRef: 3D-FC30099
Discontinued product



