CymitQuimica logo

CAS 845879-27-8

:

3-Chloro-5-[[(4-methylphenyl)methyl]sulfinyl]-1,2,4-thiadiazole

Description:
3-Chloro-5-[[(4-methylphenyl)methyl]sulfinyl]-1,2,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a chlorine atom, and a sulfinyl group attached to a methyl-substituted phenyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiadiazole ring, which is known for its role in various pharmacological applications. The sulfinyl group may enhance the compound's reactivity and solubility in organic solvents. Additionally, the presence of the chlorine atom can influence the compound's electronic properties and stability. As a result, 3-Chloro-5-[[(4-methylphenyl)methyl]sulfinyl]-1,2,4-thiadiazole may be of interest in medicinal chemistry and agrochemical research, where it could serve as a lead compound for the development of new therapeutic agents or pesticides. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C10H9ClN2OS2
InChI:InChI=1S/C10H9ClN2OS2/c1-7-2-4-8(5-3-7)6-16(14)10-12-9(11)13-15-10/h2-5H,6H2,1H3
InChI key:InChIKey=KXQKHMPTGGKSMG-UHFFFAOYSA-N
SMILES:S(CC1=CC=C(C)C=C1)(=O)C=2SN=C(Cl)N2
Synonyms:
  • 1,2,4-Thiadiazole, 3-chloro-5-[[(4-methylphenyl)methyl]sulfinyl]-
  • 3-Chloro-5-[[(4-methylphenyl)methyl]sulfinyl]-1,2,4-thiadiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.