CAS 845879-33-6

6-Chloro-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenoxy]benzothiazole

Description:

6-Chloro-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenoxy]benzothiazole is a complex organic compound characterized by its unique structural features, which include a benzothiazole core, chloro and nitro substituents, and a trifluoromethyl group. The presence of the chloro group enhances its reactivity, while the nitro group can influence its electronic properties and solubility. The trifluoromethyl group is known for imparting lipophilicity and can significantly affect the compound's biological activity. This compound may exhibit various properties such as potential antimicrobial or anticancer activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could interact with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, such as pH and temperature. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.

Formula: C₂₀H₁₀ClF₃N₂O₄S

InChI: InChI=1S/C20H10ClF3N2O4S/c21-12-2-7-15-18(10-12)31-19(25-15)30-14-5-3-13(4-6-14)29-17-8-1-11(20(22,23)24)9-16(17)26(27)28/h1-10H

InChI key: InChIKey=PKZXTBOCXAYDKO-UHFFFAOYSA-N

SMILES: O(C=1SC=2C(N1)=CC=C(Cl)C2)C3=CC=C(OC4=C(N(=O)=O)C=C(C(F)(F)F)C=C4)C=C3

Synonyms:

• Benzothiazole, 6-chloro-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenoxy]-
• 6-Chloro-2-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenoxy]benzothiazole