CymitQuimica logo

CAS 845885-81-6

:

2-Bromo-1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl]ethanone

Description:
2-Bromo-1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl]ethanone, with the CAS number 845885-81-6, is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, a bromine atom, and a trifluoromethyl group. This compound typically exhibits a moderate to high level of lipophilicity due to the presence of the trifluoromethyl and aromatic groups, which can influence its solubility in organic solvents. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The bromine substituent may enhance reactivity and serve as a site for further chemical modifications. Additionally, the presence of multiple functional groups suggests that this compound could participate in various chemical reactions, making it of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental methods or detailed literature review for practical applications.
Formula:C13H9BrF3NOS
InChI:InChI=1S/C13H9BrF3NOS/c1-7-11(10(19)6-14)20-12(18-7)8-2-4-9(5-3-8)13(15,16)17/h2-5H,6H2,1H3
InChI key:InChIKey=XGHUMHHAMHEPCS-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C=1SC(=NC1C)C2=CC=C(C(F)(F)F)C=C2
Synonyms:
  • 2-Bromo-1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl]ethanone
  • 2-Bromo-1-{4-Methyl-2-[4-(Trifluoromethyl)Phenyl]-1,3-Thiazol-5-Yl}-1-Ethanone
  • Ethanone, 2-bromo-1-[4-methyl-2-[4-(trifluoromethyl)phenyl]-5-thiazolyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.